A5248512
                    Liquiritin , ≥98%(HPLC) , 551-15-5
                            Synonym(s):
4′,7-Dihydroxyflavanone 4′-glucoside;Liquiritoside
                            
                        
                | Pack Size | Price | Stock | Quantity | 
| 10MG | RMB55.20 | In Stock | 
                                                 | 
                                        
| 50MG | RMB159.20 | In Stock | 
                                                 | 
                                        
| 250mg | RMB508.80 | In Stock | 
                                                 | 
                                        
| 1g | RMB1324.00 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 208 °C(Solv: ethanol (64-17-5)) | 
                                    
| Boiling point: | 746.8±60.0 °C(Predicted) | 
                                    
| Density | 1.529±0.06 g/cm3(Predicted) | 
                                    
| storage temp. | Sealed in dry,2-8°C | 
                                    
| solubility | DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) | 
                                    
| form | Solid | 
                                    
| pka | 7.70±0.40(Predicted) | 
                                    
| color | White to Off-White | 
                                    
| biological source | Glycyrrhizae root (licorice root) | 
                                    
| Stability: | Light Sensitive | 
                                    
| InChIKey | DEMKZLAVQYISIA-ZRWXNEIDSA-N | 
                                    
| SMILES | O=C1C[C@@H](C2C=CC(O[C@H]3[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O3)O)=CC=2)OC2=CC(O)=CC=C12 |&1:3,9,10,11,13,15,r| | 
                                    
Description and Uses
Liquiritin is a major constituent of Glycyrrhiza Radix that has a neuroprotective effect against glutamate toxicity in DPC12 cells and may have potential for the treatment of neurodegenerative diseases.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H302-H315-H319-H335 | 
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 | 
| WGK Germany | 3 | 
| HS Code | 29389090 | 





