PRODUCT Properties
| Melting point: | 208 °C(Solv: ethanol (64-17-5)) |
| Boiling point: | 746.8±60.0 °C(Predicted) |
| Density | 1.529±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 7.70±0.40(Predicted) |
| color | White to Off-White |
| biological source | Glycyrrhizae root (licorice root) |
| Stability: | Light Sensitive |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChIKey | DEMKZLAVQYISIA-ZRWXNEIDSA-N |
| SMILES | O=C1C[C@@H](C2C=CC(O[C@H]3[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O3)O)=CC=2)OC2=CC(O)=CC=C12 |&1:3,9,10,11,13,15,r| |
Description and Uses
Liquiritin is a major constituent of Glycyrrhiza Radix that has a neuroprotective effect against glutamate toxicity in DPC12 cells and may have potential for the treatment of neurodegenerative diseases.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| WGK Germany | 3 |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |





