A5250912
3-Iodo-2-methoxypyridine , 97% , 112197-15-6
CAS NO.：112197-15-6
Empirical Formula: C6H6INO
Molecular Weight: 235.02
MDL number: MFCD03094946
EINECS: 622-890-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB37.60 | In Stock |
|
| 5G | RMB68.80 | In Stock |
|
| 25g | RMB298.40 | In Stock |
|
| 100g | RMB1167.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 66 °C(Solv: hexane (110-54-3)) |
| Boiling point: | 85 °C/3 mmHg |
| Density | 1.87 |
| refractive index | 1.62 |
| Flash point: | Not applicable |
| storage temp. | 2-8°C |
| pka | 1.38±0.10(Predicted) |
| form | clear liquid |
| color | Light yellow to Brown |
| Sensitive | Light Sensitive |
| InChI | InChI=1S/C6H6INO/c1-9-6-5(7)3-2-4-8-6/h2-4H,1H3 |
| InChIKey | BXCHJERCAUZLOE-UHFFFAOYSA-N |
| SMILES | C1(OC)=NC=CC=C1I |
| CAS DataBase Reference | 112197-15-6(CAS DataBase Reference) |
Description and Uses
3-Iodo-2-methoxypyridine serves as a synthesis precursor in modified Sonogashira coupling reactions to produce 2-methoxypyridine derivatives such as 2-methoxy-3-[(2-methyl-4-thiazolyl)ethynyl]pyridine[6].
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22-41-37/38-22-36/37/39 |
| Safety Statements | 36/37/39-26-37 |
| RIDADR | UN 3334 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
