A5301712
L-Anserine Nitrate Salt , 98% , 10030-52-1
Synonym(s):
β-Ala-3-methyl-His nitrate salt;β-Alanyl-3-methyl-L -histidine nitrate salt
CAS NO.:10030-52-1
Empirical Formula: C10H17N5O6
Molecular Weight: 303.27
MDL number: MFCD00037001
EINECS: 233-079-7
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB55.20 | In Stock |
|
| 250MG | RMB158.40 | In Stock |
|
| 1g | RMB511.20 | In Stock |
|
| 5g | RMB1551.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 226-228°C |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | Water (Slightly) |
| form | Solid |
| color | White to Off-White |
| Stability: | Hygroscopic |
| Major Application | detection |
| InChI | InChI=1/C10H16N4O3.HNO3/c1-14-6-12-5-7(14)4-8(10(16)17)13-9(15)2-3-11;2-1(3)4/h5-6,8H,2-4,11H2,1H3,(H,13,15)(H,16,17);(H,2,3,4)/t8-;/s3 |
| InChIKey | OLWOKAYJAHHSNY-QRPNPIFTSA-N |
| SMILES | C(C1=CN=CN1C)[C@@H](C(=O)O)NC(=O)CCN.N(O)(=O)=O |&1:7,r| |
Description and Uses
detection
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






