A6248812
3-N-Methyl-L-histidine , 98% , 368-16-1
Synonym(s):
π-Methyl-L -histidine;1-Methyl-L -histidine (archaic);3-(1-Methylimidazol-5-yl)-L -alanine
CAS NO.:368-16-1
Empirical Formula: C7H11N3O2
Molecular Weight: 169.18
MDL number: MFCD08273564
EINECS: 206-704-6
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB239.20 | In Stock |
|
| 250MG | RMB559.20 | In Stock |
|
| 1G | RMB1599.20 | In Stock |
|
| 5g | RMB6639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 248~252℃ |
| Boiling point: | 298.47°C (rough estimate) |
| alpha | +12.0~+18.0°(20℃/D)(c=2,dil.HCl) |
| Density | 1.37 |
| refractive index | 1.5950 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | PBS (pH 7.2): 10 mg/ml |
| form | A crystalline solid |
| pka | 2.04±0.10(Predicted) |
| color | White to off-white |
| optical activity | -25.818 (H2O) |
| Stability: | Hygroscopic |
| Major Application | detection |
| InChI | InChI=1S/C7H11N3O2/c1-10-4-9-3-5(10)2-6(8)7(11)12/h3-4,6H,2,8H2,1H3,(H,11,12)/t6-/m0/s1 |
| InChIKey | JDHILDINMRGULE-LURJTMIESA-N |
| SMILES | C(O)(=O)[C@H](CC1N(C)C=NC=1)N |
| CAS DataBase Reference | 368-16-1(CAS DataBase Reference) |
Description and Uses
3-Methyl-L-histidine is a potential compound to be used as a treatment with pharmacological PPARα agonists to stimulate the ubiquitin proteasome pathway and myofibrillar protein breakdown in skeleta l muscle of rodents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |







