3-Methyl-4-nitropyridine N-oxide , 98% , 1074-98-2
CAS NO.:1074-98-2
Empirical Formula: C6H6N2O3
Molecular Weight: 154.12
MDL number: MFCD00014626
EINECS: 214-050-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB26.40 | In Stock |
|
| 5G | RMB68.00 | In Stock |
|
| 25G | RMB253.60 | In Stock |
|
| 100G | RMB736.80 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 135-139 °C |
| Boiling point: | 277.46°C (rough estimate) |
| Density | 1.4564 (rough estimate) |
| refractive index | 1.5100 (estimate) |
| storage temp. | 2-8°C |
| pka | -1.22±0.10(Predicted) |
| form | Crystalline Needles or Powder |
| color | Yellow |
| BRN | 140157 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C6H6N2O3/c1-5-4-7(9)3-2-6(5)8(10)11/h2-4H,1H3 |
| InChIKey | SSOURMYKACOBIV-UHFFFAOYSA-N |
| SMILES | C1[N+]([O-])=CC=C([N+]([O-])=O)C=1C |
| CAS DataBase Reference | 1074-98-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Nitro-3-picoline-n-oxide(1074-98-2) |
Description and Uses
3-Methyl-4-nitropyridine N-Oxide is slightly soluble in water and soluble in common organic solvents such as ethanol. It belongs to the pyridine N-oxide class of heterocyclic compounds. It should be stored in a dry, cool, dark place away from heat sources and strong oxidants. This substance has a certain degree of toxicity, and protective measures should be taken when handling it. It is a core heterocyclic intermediate in the fields of medicine and pesticides and is mainly used to synthesize pyridine drugs and agricultural chemicals.
diagnostic assay manufacturing
hematology
histology
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335-H351 |
| Precautionary statements | P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338-P308+P313 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 40-20/21/22-36/37/38 |
| Safety Statements | 45-36/37-36-26-22 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | UT5775000 |
| Hazard Note | Irritant/Possible Mutagen |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







