PRODUCT Properties
| Melting point: | 28-32 °C |
| Boiling point: | 250 °C |
| Density | 1.5100 (rough estimate) |
| refractive index | 1.5905 (estimate) |
| storage temp. | 2-8°C(protect from light) |
| form | powder to lump to clear liquid |
| color | White or Colorless to Light yellow |
| Sensitive | Light Sensitive |
| BRN | 1860064 |
| InChI | InChI=1S/C9H11I/c1-6-4-7(2)9(10)8(3)5-6/h4-5H,1-3H3 |
| InChIKey | GTPNXFKONRIHRW-UHFFFAOYSA-N |
| SMILES | C1(C)=CC(C)=CC(C)=C1I |
| CAS DataBase Reference | 4028-63-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,4,6-Trimethyliodobenzene(4028-63-1) |
Description and Uses
Iodomesitylene can be used as a good catalyst for living radical polymerization due to its good molecular weight distribution.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305+P351+P338 |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36/37/39-24/28 |
| HazardClass | LIGHT SENSITIVE |
| HS Code | 29039990 |
