A5394812
Methyl 5-methylisoxazole-3-carboxylate , 98% , 19788-35-3
CAS NO.：19788-35-3
Empirical Formula: C6H7NO3
Molecular Weight: 141.12
MDL number: MFCD00015895
EINECS: 243-311-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB39.20 | In Stock |
|
| 5G | RMB183.20 | In Stock |
|
| 25G | RMB535.20 | In Stock |
|
| 100g | RMB1919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 90-92 °C |
| Boiling point: | 125°C 11mm |
| Density | 1.179±0.06 g/cm3(Predicted) |
| Flash point: | 125°C/11mm |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | solid |
| pka | -5.08±0.50(Predicted) |
| color | White to off-white |
| BRN | 115704 |
| InChI | InChI=1S/C6H7NO3/c1-4-3-5(7-10-4)6(8)9-2/h3H,1-2H3 |
| InChIKey | MVHHQOCEOUNTID-UHFFFAOYSA-N |
| SMILES | O1C(C)=CC(C(OC)=O)=N1 |
| CAS DataBase Reference | 19788-35-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Isoxazolecarboxylic acid, 5-methyl-, methyl ester(19788-35-3) |
Description and Uses
Methyl 5-Methyl-3-isoxazolecarboxylate is a related compound of Leflunomide (L322750), an antirheumatic compound used to treat rheumatoid arthritis and psoriatic arthritis. Leflunomide also inhibits dihydroorotate dehydrogenase.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| HS Code | 29349990 |
