A5397412
Maltotriose , Analysis standard , 1109-28-0
Synonym(s):
α-D -Glc-(1→4)-α-D -Glc-(1→4)-D -Glc;Maltotriose;O-α-D D-Glucopyranosyl-(1→4)-O-α-D -glucopyranosyl-(1→4)-D -glucose
CAS NO.:1109-28-0
Empirical Formula: C18H32O16
Molecular Weight: 504.44
MDL number: MFCD00006629
EINECS: 214-174-2
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 132-135 °C |
| Boiling point: | 513.84°C (rough estimate) |
| Density | 1.4403 (rough estimate) |
| refractive index | 1.6760 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | H2O: 50 mg/mL, clear, colorless |
| form | Powder |
| pka | 12.39±0.20(Predicted) |
| color | White to Off-white |
| optical activity | +160 |
| Water Solubility | Soluble in water. |
| BRN | 1443481 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Major Application | agriculture |
| InChIKey | FYGDTMLNYKFZSV-DZOUCCHMSA-N |
| SMILES | [H][C@]1(O)O[C@H](CO)[C@@H](O[C@@]2([H])O[C@H](CO)[C@@H](O[C@@]3([H])O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O |
| LogP | -4.137 (est) |
| CAS DataBase Reference | 1109-28-0(CAS DataBase Reference) |
Description and Uses
displays potent and selective in vitro anti-human immunodeficiency virus type 1 activity. Prepared by modification of lysine e-amino groups
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 29400090 |
| Storage Class | 11 - Combustible Solids |




