A5398812
Morin hydrate , >90% , 654055-01-3
CAS NO.:654055-01-3
Empirical Formula: C15H12O8
Molecular Weight: 320.251
MDL number: MFCD00006826
EINECS: 684-856-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB124.00 | In Stock |
|
| 5G | RMB315.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 299-300 °C (dec.)(lit.) |
| storage temp. | room temp |
| solubility | methanol: soluble50mg/mL |
| form | powder |
| Colour Index | 75660 |
| color | yellow |
| Merck | 14,6269 |
| BRN | 327474 |
| InChI | InChI=1S/C15H10O7.H2O/c16-6-1-2-8(9(18)3-6)15-14(21)13(20)12-10(19)4-7(17)5-11(12)22-15;/h1-5,16-19,21H;1H2 |
| InChIKey | MYUBTSPIIFYCIU-UHFFFAOYSA-N |
| SMILES | O=C1C(=C(C2C=CC(O)=CC=2O)OC2=CC(O)=CC(O)=C12)O.O |
Description and Uses
Morin hydrate has been used:
- to investigate its antitumor functionality using cell viability and apoptosis assay in human cancer cell lines.
- as a fluorescence stain to detect aluminum in motor neurons and lumbar cord.
- to study its protective effect on neuronal hearing loss and on neural stem cells (NSCs) proliferation and differentiation
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38-25 |
| Safety Statements | 26-36-45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| RTECS | LK8749000 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29329990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |





