A5422512
1-Methylbenzimidazole , 99% , 1632-83-3
CAS NO.:1632-83-3
Empirical Formula: C8H8N2
Molecular Weight: 132.16
MDL number: MFCD00192275
EINECS: 605-321-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB39.20 | In Stock |
|
| 5G | RMB91.20 | In Stock |
|
| 10g | RMB159.20 | In Stock |
|
| 25G | RMB316.00 | In Stock |
|
| 100g | RMB1519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 59-62 °C(lit.) |
| Boiling point: | 154 °C12 mm Hg(lit.) |
| Density | 1.1254 |
| refractive index | 1.6013 |
| Flash point: | 154°C/12mm |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in methanol. |
| pka | 5.40±0.10(Predicted) |
| form | Solid |
| color | White to pink |
| λmax | 277nm(H2O)(lit.) |
| InChI | InChI=1S/C8H8N2/c1-10-6-9-7-4-2-3-5-8(7)10/h2-6H,1H3 |
| InChIKey | FGYADSCZTQOAFK-UHFFFAOYSA-N |
| SMILES | C1N(C)C2=CC=CC=C2N=1 |
| CAS DataBase Reference | 1632-83-3(CAS DataBase Reference) |
Description and Uses
1-Methylbenzimidazole is the suitable reagent used as electrolyte additive for the dye-sensitized solar cells and solid-state dye-sensitized solar cells.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-36/39 |
| WGK Germany | 3 |
| HS Code | 29339980 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |




![7H-benzo[de]benzo[4,5]imidazo[2,1-a]isoquinolin-7-one](https://img.chemicalbook.com/CAS/GIF/23749-58-8.gif)



![Benzo[4,5]imidazo[1,2-c]quinazoline-6-thiol](https://img.chemicalbook.com/CAS/GIF/24192-82-3.gif)