MagnesonⅠ , High -pure level, 90% , 74-39-5
Synonym(s):
4-(4-Nitrophenylazo)-resorcinol;Azoviolet;Magneson I
CAS NO.:74-39-5
Empirical Formula: C12H9N3O4
Molecular Weight: 259.22
MDL number: MFCD00007310
EINECS: 200-808-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB48.00 | In Stock |
|
| 25G | RMB188.80 | In Stock |
|
| 100G | RMB412.00 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 195-200 °C (dec.)(lit.) |
| Boiling point: | 402.47°C (rough estimate) |
| Density | 1.3450 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| storage temp. | Store below +30°C. |
| form | Powder |
| pka | 8.05±0.35(Predicted) |
| color | Orange-red to red |
| Appearance | Red, Orange or Red-Orange Powder |
| Odor | Odorless |
| Water Solubility | Soluble in dilute sodium hydroxide. Insoluble in water. |
| λmax | 432 nm |
| Merck | 14,5695 |
| BRN | 674709 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases. |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C12H9N3O4/c16-10-5-6-11(12(17)7-10)14-13-8-1-3-9(4-2-8)15(18)19/h1-7,16-17H/b14-13+ |
| InChIKey | NGPGYVQZGRJHFJ-BUHFOSPRSA-N |
| SMILES | Oc1ccc(\N=N\c2ccc(cc2)[N+]([O-])=O)c(O)c1 |
| CAS DataBase Reference | 74-39-5(CAS DataBase Reference) |
| EPA Substance Registry System | 1,3-Benzenediol, 4-[(4-nitrophenyl)azo]- (74-39-5) |
Description and Uses
Oxygen violet can be prepared by one-step reaction of p-nitroaniline and 1,3-benzenediol. Azo violet can be used to prepare an azobenzene photochromic liquid crystal compound. Photochromic liquid crystal compounds have both photochromic properties and liquid crystallinity, which has become a research hotspot in the field of information storage. Azobenzene-based liquid crystals are the most interesting photochromic liquid crystal materials in recent years due to their unique photoinduced cis-trans isomerism. Azobenzene compounds undergo reversible cis-trans isomerization under the action of light, which makes them have great potential applications in many aspects such as optical storage, photo-holography and optical information processing.
4-(4-Nitrophenyl)azoresorcinol is used for the detection of magnesium with which it yields a bright blue color in alkaline solution and it also used to determine molybdenum with which it forms a red-violet complex: Nikitina, Andrianova, C.A. 75, 136789v (1971).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | VH2810000 |
| TSCA | TSCA listed |
| HS Code | 29270000 |
| Storage Class | 11 - Combustible Solids |





