A5447112
6-Methoxy-3-pyridinecarboxaldehyde , 97% , 65873-72-5
Synonym(s):
6-Methoxy-3-nicotinaldehyde
CAS NO.:65873-72-5
Empirical Formula: C7H7NO2
Molecular Weight: 137.14
MDL number: MFCD02683446
EINECS: 627-354-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB47.20 | In Stock |
|
| 5G | RMB125.60 | In Stock |
|
| 25G | RMB496.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 51-54 °C (lit.) |
| Boiling point: | 65-70 °C(Press: 12 Torr) |
| Density | 1.159±0.06 g/cm3(Predicted) |
| Flash point: | 225 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 1.60±0.10(Predicted) |
| form | Crystalline Powder |
| color | Off-white to light yellow |
| Water Solubility | insoluble |
| InChI | InChI=1S/C7H7NO2/c1-10-7-3-2-6(5-9)4-8-7/h2-5H,1H3 |
| InChIKey | CTAIEPPAOULMFY-UHFFFAOYSA-N |
| SMILES | C1=NC(OC)=CC=C1C=O |
| CAS DataBase Reference | 65873-72-5(CAS DataBase Reference) |
Description and Uses
Substrate used in a synthesis of flavanones via an L-proline-catalyzed condensation with o-hydroxyarylketones.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







