A5541512
6-Methoxypyridine-2-carboxylic acid , ≥98.0%(GC) , 26893-73-2
Synonym(s):
6-Methoxypicolinic acid
| Pack Size | Price | Stock | Quantity |
| 1G | RMB67.20 | In Stock |
|
| 5G | RMB205.60 | In Stock |
|
| 25G | RMB667.20 | In Stock |
|
| 100G | RMB2351.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 38.5-39.5°C |
| Boiling point: | 300.8±22.0 °C(Predicted) |
| Density | 1.284±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Methanol[soluble in] |
| form | powder to crystal |
| pka | 3.52±0.10(Predicted) |
| color | White to Almost white |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C7H7NO3/c1-11-6-4-2-3-5(8-6)7(9)10/h2-4H,1H3,(H,9,10) |
| InChIKey | QCCJUEURAZMEGY-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=NC(OC)=CC=C1 |
| CAS DataBase Reference | 26893-73-2(CAS DataBase Reference) |
Description and Uses
It is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuffs.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
