A5455212
Melatonin , 98% , 73-31-4
Synonym(s):
Melatonin;Melatonine;N-Acetyl-5-methoxytryptamine;N-Acetyl-5-methoxytryptamine, 5-Methoxy-N-acetyltryptamine;N-Acetyl-5-methoxytryptamine
CAS NO.:73-31-4
Empirical Formula: C13H16N2O2
Molecular Weight: 232.28
MDL number: MFCD00005655
EINECS: 200-797-7
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB36.00 | In Stock |
|
| 5G | RMB43.20 | In Stock |
|
| 25G | RMB123.20 | In Stock |
|
| 100G | RMB343.20 | In Stock |
|
| 500g | RMB1436.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 116.5-118 °C (lit.) |
| Boiling point: | 374.44°C (rough estimate) |
| Density | 1.1099 (rough estimate) |
| refractive index | 1.6450 (estimate) |
| Flash point: | 9℃ |
| storage temp. | -20°C |
| solubility | Soluble in ethanol to at least 50mg/ml |
| pka | 16.26±0.46(Predicted) |
| form | Powder |
| color | white to off-white |
| biological source | synthetic (organic) |
| Merck | 14,5816 |
| BRN | 205542 |
| Specific Activity | 53-71nmol/min·mg |
| Henry's Law Constant | 3.8×108 mol/(m3Pa) at 25℃, HSDB (2015) |
| Cosmetics Ingredients Functions | ANTIOXIDANT |
| InChI | 1S/C13H16N2O2/c1-9(16)14-6-5-10-8-15-13-4-3-11(17-2)7-12(10)13/h3-4,7-8,15H,5-6H2,1-2H3,(H,14,16) |
| InChIKey | DRLFMBDRBRZALE-UHFFFAOYSA-N |
| SMILES | COc1ccc2[nH]cc(CCNC(C)=O)c2c1 |
| LogP | 1.043 (est) |
| CAS DataBase Reference | 73-31-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Melatonin(73-31-4) |
Description and Uses
Melatonin, at times referred to as the “hormone of darkness,” normally is secreted during the night. It is synthesized in the pineal gland, and its secretion is controlled by the suprachiasmatic nucleus, following an endogenous circadian rhythm. Studies indicate that melatonin may
Melatonin has complex effects on apoptotic pathways, inhibiting apoptosis in immune cells and neurons but enhancing apoptotic cell death of cancer cells. Inhibits proliferation/metastasis of breast cancer cells by inhibiting estrogen receptor action.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H370 |
| Precautionary statements | P210-P260-P280-P301+P310-P311 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | T,F |
| Risk Statements | 60-39/23/24/25-23/24/25-11 |
| Safety Statements | 24/25-99-53-45-36/37-16-7 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 2 |
| RTECS | AC5955000 |
| F | 8-10-23 |
| HS Code | 29379000 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 73-31-4(Hazardous Substances Data) |
| Toxicity | LD50 orally in Rabbit: > 3200 mg/kg |








