5-Methoxytryptamine , 10mMinDMSO , 608-07-1
Synonym(s):
5-Methoxytryptamine;5-Methoxytryptamine hydrochloride;2-(5-Methoxyindol-3-yl)ethylamine;3-(2-Aminoethyl)-5-methoxyindole;5-MOT
CAS NO.:608-07-1
Empirical Formula: C11H14N2O
Molecular Weight: 190.24
MDL number: MFCD00005662
EINECS: 210-153-7
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 121-123 °C (lit.) |
| Boiling point: | 325.75°C (rough estimate) |
| Density | 1.0815 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | crystalline |
| pka | 16.91±0.30(Predicted) |
| color | white |
| Merck | 13,6032 |
| BRN | 145587 |
| InChI | InChI=1S/C11H14N2O/c1-14-9-2-3-11-10(6-9)8(4-5-12)7-13-11/h2-3,6-7,13H,4-5,12H2,1H3 |
| InChIKey | JTEJPPKMYBDEMY-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(OC)C=C2)C(CCN)=C1 |
| CAS DataBase Reference | 608-07-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 5-Methoxytryptamine(608-07-1) |
Description and Uses
5-Methoxytryptamine (5-MT), also known as mexamine, is a tryptamine derivative closely related to the neurotransmitters serotonin and melatonin. 5-MT has been shown to occur naturally in the body in low levels.It is biosynthesized via the deacetylation of melatonin in the pineal gland.
The protective effect of 5-methoxytryptamine (a metabolite of melatonin) in human keratinocytes against ultraviolet B (UVB) radiation was studied.
Melatonin and its metabolites ameliorate ultraviolet B-induced damage in human epidermal keratinocytes.
5-Methoxytryptamine (Mexamine, Methoxytryptamine) is a tryptamine derivative that is closely related to the neurotransmitter Melatonin (M215000) and Serotonin (S274980). It acts as a full agonist at the 5-HT1, 5-HT2, 5-HT4, 5-HT6, and 5-HT7 receptors but has no affinity for the 5-HT3 receptor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38-20/21/22 |
| Safety Statements | 36-26 |
| WGK Germany | 3 |
| RTECS | NL4110000 |
| F | 8 |
| HS Code | 29339900 |
| Toxicity | LD50 intraperitoneal in mouse: 176mg/kg |







