A5458212
2-Methyl-6-nitrobenzoic Acid , 98% , 13506-76-8
Synonym(s):
6-Nitro-o-toluic acid
CAS NO.:13506-76-8
Empirical Formula: C8H7NO4
Molecular Weight: 181.15
MDL number: MFCD00007267
EINECS: 236-833-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB62.40 | In Stock |
|
| 10g | RMB127.20 | In Stock |
|
| 25G | RMB220.80 | In Stock |
|
| 100G | RMB740.00 | In Stock |
|
| 500g | RMB2590.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 153-157 °C (lit.) |
| Boiling point: | 314.24°C (rough estimate) |
| Density | 1.4283 (rough estimate) |
| refractive index | 1.5468 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO, Methanol |
| form | Solid |
| pka | pK1:1.87 (25°C) |
| color | Pale Yellow |
| BRN | 2050804 |
| InChI | InChI=1S/C8H7NO4/c1-5-3-2-4-6(9(12)13)7(5)8(10)11/h2-4H,1H3,(H,10,11) |
| InChIKey | CCXSGQZMYLXTOI-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=C([N+]([O-])=O)C=CC=C1C |
| CAS DataBase Reference | 13506-76-8(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Methyl-6-nitrobenzoic acid (13506-76-8) |
Description and Uses
2-Methyl-nitrobenzoic acid acts as herbicide due to the anthranilic acid moiety within the substructure.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |







