A5497612
4-Methyl-1-naphthoic acid , 98% , 4488-40-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB30.40 | In Stock |
|
| 25G | RMB112.80 | In Stock |
|
| 100G | RMB334.40 | In Stock |
|
| 500g | RMB1519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 179-181 °C (lit.) |
| Boiling point: | 387.4±11.0 °C(Predicted) |
| Density | 1.222±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO, Methanol |
| pka | 3.78±0.10(Predicted) |
| form | Solid |
| color | Off-White |
| InChI | InChI=1S/C12H10O2/c1-8-6-7-11(12(13)14)10-5-3-2-4-9(8)10/h2-7H,1H3,(H,13,14) |
| InChIKey | SIVYRLBDAPKADZ-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=C2C(C=CC=C2)=C(C)C=C1 |
Description and Uses
4-Methyl-1-naphthoic acid may be used to synthesize:
- 2-methyl-1-propyl-3-(4-methyl-1-naphthoyl)indole, JWH-148
- 4-methyl-1-naphthylcarbinol
- 1,4-dioxan-2-yl 4-methyl-1-naphthoate
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HS Code | 29163990 |
