A5501312
Methyl 3-methoxy-4-methylbenzoate , 98% , 3556-83-0
CAS NO.：3556-83-0
Empirical Formula: C10H12O3
Molecular Weight: 180.2
MDL number: MFCD00082710
EINECS: 609-142-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB39.20 | In Stock |
|
| 5G | RMB95.76 | In Stock |
|
| 25G | RMB253.60 | In Stock |
|
| 100g | RMB1008.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 50-54 °C (lit.) |
| Boiling point: | 119-120°C 1mm |
| Density | 1.075±0.06 g/cm3(Predicted) |
| refractive index | 1.5295 |
| Flash point: | >230 °F |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 1948339 |
| InChI | InChI=1S/C10H12O3/c1-7-4-5-8(10(11)13-3)6-9(7)12-2/h4-6H,1-3H3 |
| InChIKey | LLEXCSBUSVRBCA-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=C(C)C(OC)=C1 |
| CAS DataBase Reference | 3556-83-0(CAS DataBase Reference) |
Description and Uses
Methyl 3-Methoxy-4-methylbenzoate has been used as a reactant in the preparation of an antimalaria drug that consists of the 4-aminoquinoline pharmacophore of chloroquine with clotrimazole-based antimalarials.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 1 |
| HS Code | 29189900 |
