A5502812
4-Methyl-1-indanone , 97% , 24644-78-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB224.00 | In Stock |
|
| 5G | RMB674.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 94-96 °C (lit.) |
| Boiling point: | 205.81°C (rough estimate) |
| Density | 0.9071 (rough estimate) |
| refractive index | 1.5530 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Crystalline Powder |
| color | White to yellow |
| InChI | InChI=1S/C10H10O/c1-7-3-2-4-9-8(7)5-6-10(9)11/h2-4H,5-6H2,1H3 |
| InChIKey | RUORWXQKVXTQJJ-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C(C)=CC=C2)CC1 |
| CAS DataBase Reference | 24644-78-8(CAS DataBase Reference) |
Description and Uses
4-Methyl-1-indanone may be used for the following syntheses:
- 3,6-dimethylcholanthrene
- 3,6-dimethyl-7-methoxycholanthrene
- 3-methyl-7-methoxycholanthrene
- methyl 4-methyl-1-fluoroindan-1-carboxylate (4-Me-FICA Me ester)
Safety
| Symbol(GHS) |    GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H410-H372 |
| Precautionary statements | P260-P264-P273-P501 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29143990 |
