A5528312
N-Methyl-p-toluenesulfonamide , >98.0%(HPLC) , 640-61-9
CAS NO.：640-61-9
Empirical Formula: C8H11NO2S
Molecular Weight: 185.24
MDL number: MFCD00008285
EINECS: 211-366-8
| Pack Size | Price | Stock | Quantity |
| 25G | RMB30.96 | In Stock |
|
| 100G | RMB74.40 | In Stock |
|
| 250g | RMB119.20 | In Stock |
|
| 500G | RMB224.00 | In Stock |
|
| 2.5KG | RMB5599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 76-79 °C (lit.) |
| Boiling point: | 296.5±33.0 °C(Predicted) |
| Density | 1.3400 |
| refractive index | 1.5650 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Very Slightly) |
| pka | 11.67±0.30(Predicted) |
| form | Crystalline Solid |
| color | White to light yellow |
| InChI | InChI=1S/C8H11NO2S/c1-7-3-5-8(6-4-7)12(10,11)9-2/h3-6,9H,1-2H3 |
| InChIKey | GWLOGZRVYXAHRE-UHFFFAOYSA-N |
| SMILES | C1(S(NC)(=O)=O)=CC=C(C)C=C1 |
| CAS DataBase Reference | 640-61-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenesulfonamide, n,4-dimethyl-(640-61-9) |
| EPA Substance Registry System | Benzenesulfonamide, N,4-dimethyl- (640-61-9) |
Description and Uses
N-Methyl-p-toluenesulfonamide was used in the synthesis of vicinal haloamino ketone derivative.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P302+P352-P362+P364 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| WGK Germany | 3 |
| HS Code | 29350090 |
