PRODUCT Properties
| Melting point: | -3°C |
| Boiling point: | 188-189 °C (lit.) |
| Density | 0.949 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 165 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly) |
| form | Oil |
| color | Clear Colourless |
| InChI | InChI=1S/C10H6/c1-3-9-6-5-7-10(4-2)8-9/h1-2,5-8H |
| InChIKey | PNXLPYYXCOXPBM-UHFFFAOYSA-N |
| SMILES | C1(C#C)=CC=CC(C#C)=C1 |
| CAS DataBase Reference | 1785-61-1(CAS DataBase Reference) |
Description and Uses
1,3-Diethynylbenzene may be used to synthesize mono- and di- 1,4-substituted-1,2,3-triazole ligands, which have the property to self-assemble into metallo-cyclic structures in the presence of silver ions.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | F,T |
| Risk Statements | 36/37/38-23/24/25-11 |
| Safety Statements | 22-24/25-36/37/39-15-3/7/9 |
| RIDADR | 3295 |
| WGK Germany | 3 |
| HazardClass | 3 |
| HS Code | 29029090 |
| Storage Class | 10 - Combustible liquids |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |




![1,3-Bis[(trimethylsilyl)ethynyl]benzene](https://img.chemicalbook.com/CAS/GIF/38170-80-8.gif)

