A5534912
3-Hydroxyisoxazole-5-carboxylic Acid Methyl Ester , 97% , 10068-07-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB36.00 | In Stock |
|
| 1G | RMB69.60 | In Stock |
|
| 5G | RMB252.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 160-163 °C(lit.) |
| Boiling point: | 261.15°C (rough estimate) |
| Density | 1.5918 (rough estimate) |
| refractive index | 1.5820 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform, Ethanol, Ether, Ethyl Acetate, Methanol |
| form | Powder |
| pka | 11.25±0.40(Predicted) |
| color | Light Yellow |
| InChI | InChI=1S/C5H5NO4/c1-9-5(8)3-2-4(7)6-10-3/h2H,1H3,(H,6,7) |
| InChIKey | BBFWUUBQSXVHHZ-UHFFFAOYSA-N |
| SMILES | O1C(C(OC)=O)=CC(=O)N1 |
| CAS DataBase Reference | 10068-07-2(CAS DataBase Reference) |
Description and Uses
Methyl 3-hydroxy-5-isoxazolecarboxylate was used in the enantioselective synthesis of a key precursor to the tetracycline antibiotics. It was also used in the preparation of formamidinopiperidine analog, an N-amidinopiperidine compound.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29349990 |
