A5541212
Methyl cyclohexylacetate , 96% , 14352-61-5
Synonym(s):
Methyl cyclohexaneacetate
| Pack Size | Price | Stock | Quantity |
| 1g | RMB72.00 | In Stock |
|
| 5g | RMB256.00 | In Stock |
|
| 10G | RMB463.20 | In Stock |
|
| 50G | RMB1839.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 201 °C (lit.) |
| Density | 0.951 g/mL at 25 °C (lit.) |
| vapor pressure | 46-84Pa at 20℃ |
| refractive index | n |
| Flash point: | 166 °F |
| storage temp. | Storage temp. 2-8°C |
| solubility | water: soluble0.3g/L at 30°C |
| form | liquid |
| Odor | at 100.00 %. fruity tropical banana mango pineapple honey |
| Appearance | Colorless to light yellow Liquid |
| Odor Type | fruity |
| Water Solubility | water: soluble 0.3g/L at30°C |
| Cosmetics Ingredients Functions | FRAGRANCE |
| InChI | InChI=1S/C9H16O2/c1-11-9(10)7-8-5-3-2-4-6-8/h8H,2-7H2,1H3 |
| InChIKey | IMXBRVLCKXGWSS-UHFFFAOYSA-N |
| SMILES | C1(CC(OC)=O)CCCCC1 |
| LogP | 1.32 at 20℃ and pH4.7-5.5 |
| NIST Chemistry Reference | Methylcyclohexylacetate(14352-61-5) |
| EPA Substance Registry System | Cyclohexaneacetic acid, methyl ester (14352-61-5) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H317-H412 |
| Precautionary statements | P273-P280 |
| Hazard Codes | Xi,N |
| Risk Statements | 38-43-52/53 |
| Safety Statements | 36/37-61 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 3 Skin Irrit. 2 Skin Sens. 1 |







