A5548312
2-Mercapto-5-nitrobenzimidazole , ≥98.0%(HPLC) , 6325-91-3
Synonym(s):
5-Nitro-2-benzimidazolethiol
| Pack Size | Price | Stock | Quantity |
| 5G | RMB126.40 | In Stock |
|
| 25G | RMB453.60 | In Stock |
|
| 100G | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 274 °C (dec.) (lit.) |
| Boiling point: | 348.4±44.0 °C(Predicted) |
| Density | 1.4666 (rough estimate) |
| refractive index | 1.6740 (estimate) |
| storage temp. | -20°C Freezer, Under inert atmosphere |
| solubility | 1 M NaOH: soluble50mg/mL, opaque, dark red |
| pka | 9.22±0.30(Predicted) |
| form | Solid |
| color | Light Yellow to Light Orange |
| BRN | 172127 |
| InChI | InChI=1S/C7H5N3O2S/c11-10(12)4-1-2-5-6(3-4)9-7(13)8-5/h1-3H,(H2,8,9,13) |
| InChIKey | YPXQSGWOGQPLQO-UHFFFAOYSA-N |
| SMILES | C1(=S)NC2=CC=C([N+]([O-])=O)C=C2N1 |
| CAS DataBase Reference | 6325-91-3(CAS DataBase Reference) |
| EPA Substance Registry System | 2H-Benzimidazole-2-thione, 1,3-dihydro-5-nitro- (6325-91-3) |
Description and Uses
2-Mercapto-5-nitrobenzimidazole is useful for treating giardiasis. Antigiardial drug.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



