A6161212
6-Nitrobenzimidazole , 98% , 94-52-0
Synonym(s):
5-Nitrobenzimidazole
CAS NO.:94-52-0
Empirical Formula: C7H5N3O2
Molecular Weight: 163.13
MDL number: MFCD00005604
EINECS: 202-341-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB42.40 | In Stock |
|
| 25G | RMB124.00 | In Stock |
|
| 100G | RMB428.80 | In Stock |
|
| 500G | RMB2031.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 207-210 °C |
| Boiling point: | 290.19°C (rough estimate) |
| Density | 1.4141 (rough estimate) |
| bulk density | 270kg/m3 |
| refractive index | 1.5500 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | 0.5g/l |
| pka | 10.95±0.10(Predicted) |
| form | Solid |
| color | Light Beige |
| PH | 6 (10g/l, H2O, 20℃)(slurry) |
| Water Solubility | <0.01 g/100 mL at 16.5 ºC |
| BRN | 7926 |
| Henry's Law Constant | 2.7×101 mol/(m3Pa) at 25℃, HSDB (2015) |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, strong bases. |
| InChI | 1S/C7H5N3O2/c11-10(12)5-1-2-6-7(3-5)9-4-8-6/h1-4H,(H,8,9) |
| InChIKey | XPAZGLFMMUODDK-UHFFFAOYSA-N |
| SMILES | [N+](=O)([O-])c1cc2[nH]cnc2cc1 |
| CAS DataBase Reference | 94-52-0(CAS DataBase Reference) |
| EPA Substance Registry System | 5-Nitrobenzimidazole (94-52-0) |
Description and Uses
Antifogging agent in photographic developers.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-40-22 |
| Safety Statements | 26-45-36/37 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | DD9800000 |
| TSCA | TSCA listed |
| HS Code | 29339990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 94-52-0(Hazardous Substances Data) |





