A7732058
2-Phenyl-5-benzimidazolesulfonicAcid , 10mMinDMSO , 27503-81-7
Synonym(s):
2-Phenyl-5-benzimidazolesulfonic acid;Ensulizole
CAS NO.:27503-81-7
Empirical Formula: C13H10N2O3S
Molecular Weight: 274.3
MDL number: MFCD00053007
EINECS: 248-502-0
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C (lit.) |
| Density | 1.3592 (rough estimate) |
| refractive index | 1.6360 (estimate) |
| storage temp. | 2-8°C |
| solubility | ethanol and water: soluble ((as sodium salt)) |
| form | Fine Crystalline Powder |
| pka | -0.87±0.40(Predicted) |
| color | White |
| Water Solubility | soluble |
| Merck | 14,3593 |
| BRN | 922664 |
| Stability: | Hygroscopic |
| Major Application | cleaning products cosmetics environmental food and beverages personal care |
| Cosmetics Ingredients Functions | UV FILTER LIGHT STABILIZER UV ABSORBER |
| InChI | 1S/C13H10N2O3S/c16-19(17,18)10-6-7-11-12(8-10)15-13(14-11)9-4-2-1-3-5-9/h1-8H,(H,14,15)(H,16,17,18) |
| InChIKey | UVCJGUGAGLDPAA-UHFFFAOYSA-N |
| SMILES | OS(=O)(=O)c1ccc2[nH]c(nc2c1)-c3ccccc3 |
| LogP | -1.42 at 25℃ |
| CAS DataBase Reference | 27503-81-7(CAS DataBase Reference) |
| EPA Substance Registry System | 1H-Benzimidazole-5-sulfonic acid, 2-phenyl- (27503-81-7) |
Description and Uses
Phenylbenzimidazole sulfonic acid or ensulizole is a water-soluble UVB absorber that can be utilized in the water phase of emulsion systems, in contrast to most oil-soluble sunscreen ingredients, allowing for a less greasy, more aesthetically pleasing formulation such as a daily use moisturizer containing sunscreen. Phenylbenzimidazole sulfonic acid boosts the SPF of organic and inorganic sunscreens. It can also be used in clear gels owing to its water solubility.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29339990 |
| Storage Class | 11 - Combustible Solids |





