A5550612
Methyl 6-Bromo-2-napthoate , ≥98.0% , 33626-98-1
Synonym(s):
Methyl 6-bromo-2-naphthoate
CAS NO.:33626-98-1
Empirical Formula: C12H9BrO2
Molecular Weight: 265.1
MDL number: MFCD00100408
EINECS: 608-896-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB31.20 | In Stock |
|
| 5G | RMB82.40 | In Stock |
|
| 25G | RMB358.40 | In Stock |
|
| 100G | RMB1131.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 123-126 °C (lit.) |
| Boiling point: | 357.0±15.0 °C(Predicted) |
| Density | 1.492±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly) |
| form | Crystalline Powder |
| color | Off-white to cream or light brown |
| BRN | 2578943 |
| InChI | InChI=1S/C12H9BrO2/c1-15-12(14)10-3-2-9-7-11(13)5-4-8(9)6-10/h2-7H,1H3 |
| InChIKey | JEUBRLPXJZOGPX-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=C(Br)C=C2)=CC=C1C(OC)=O |
| CAS DataBase Reference | 33626-98-1(CAS DataBase Reference) |
Description and Uses
Methyl 6-bromo-2-naphthoate may be used to synthesize:
- 6-vinyl-2-naphthalencarbaldehyde
- methyl 6-(3-tert-butyl-4-methoxyphenyl)-2-naphthoate
- methyl 6-[3-tert-butyl-4-[(tert-butyldiethylsilyl)oxy]-phenyl]-2-naphthoate
- methyl 6-[3-(1-adamantyl)-4-[(tert-butyldimethylsilyl)-oxy]phenyl]-2-naphthoate
- methyl 6-[3-(1-adamantyl)-4-[[(2,3-dimethyl-1,3-dioxolan-4-yl)methylloxy]phenyl]-2-naphthoate
- 2-bromo-6-(bromomethyl)naphthalene
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H315-H319-H335 |
| Precautionary statements | P210-P233-P240-P241-P242-P243-P260-P261-P264-P271-P280-P302+P352-P303+P361+P353-P304-P304+P340-P305+P351+P338-P312-P321-P332+P313-P337+P313-P340-P362-P370+P378-P403-P403+P233-P403+P235-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | C |
| Risk Statements | 20/21/22-34 |
| Safety Statements | 24/25-45-36/37/39-27-26 |
| WGK Germany | 3 |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |







