A5604812
Methyl 5-Bromovalerate , >97.0%(GC) , 5454-83-1
CAS NO.：5454-83-1
Empirical Formula: C6H11BrO2
Molecular Weight: 195.05
MDL number: MFCD00000265
EINECS: 226-709-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB56.00 | In Stock |
|
| 10g | RMB87.20 | In Stock |
|
| 25G | RMB156.80 | In Stock |
|
| 100G | RMB519.20 | In Stock |
|
| 500g | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 79-80°C 4mm |
| Density | 1.363 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 211 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| Specific Gravity | 1.363 |
| color | Clear colorless to brown |
| Water Solubility | Slightly soluble in water. |
| BRN | 1749649 |
| InChI | InChI=1S/C6H11BrO2/c1-9-6(8)4-2-3-5-7/h2-5H2,1H3 |
| InChIKey | RAVVJKCSZXAIQP-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)CCCCBr |
| CAS DataBase Reference | 5454-83-1(CAS DataBase Reference) |
| EPA Substance Registry System | Methyl 5-bromovalerate (5454-83-1) |
Description and Uses
It is employed as an intermediate in the production of Apixaban .
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29159080 |
