A5630112
Mono-2-ethylhexyl (2-Ethylhexyl)phosphonate , >95.0%(T) , 14802-03-0
CAS NO.:14802-03-0
Empirical Formula: C16H35O3P
Molecular Weight: 306.42
MDL number: MFCD00467188
EINECS: 238-865-3
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB23.20 | In Stock |
|
| 25ML | RMB50.40 | In Stock |
|
| 100ML | RMB143.20 | In Stock |
|
| 500ml | RMB570.40 | In Stock |
|
| 2.5L | RMB2271.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 390.6±25.0 °C(Predicted) |
| Density | 0.953±0.06 g/cm3(Predicted) |
| refractive index | 1.4480-1.4520 |
| Flash point: | 173°C(lit.) |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 2.95±0.10(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow |
| InChI | InChI=1S/C16H35O3P/c1-5-9-11-15(7-3)13-19-20(17,18)14-16(8-4)12-10-6-2/h15-16H,5-14H2,1-4H3,(H,17,18) |
| InChIKey | ZDFBXXSHBTVQMB-UHFFFAOYSA-N |
| SMILES | P(CC(CC)CCCC)(=O)(O)OCC(CC)CCCC |
| EPA Substance Registry System | Phosphonic acid, (2-ethylhexyl)-, mono(2-ethylhexyl) ester (14802-03-0) |
Description and Uses
2-ethylhexyl hydrogen -2-ethylhexylphosphonate belongs to ester organic matter, an acidic phosphorus type extractant, which is used for the extraction and separation of rare earth elements and non-ferrous metals.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H290-H302-H314-H412 |
| Precautionary statements | P234-P260-P264-P270-P273-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P405-P406-P501 |
| RIDADR | 3265 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29349990 |






