A5652012
2-Methyl-4,5-diphenylthiazole , >97.0%(GC) , 3755-83-7
CAS NO.:3755-83-7
Empirical Formula: C16H13NS
Molecular Weight: 251.35
MDL number: MFCD00186396
EINECS: 223-161-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB159.20 | In Stock |
|
| 5G | RMB528.00 | In Stock |
|
| 25g | RMB2279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 44-50 °C (lit.) |
| storage temp. | 2-8°C, stored under nitrogen |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | Light orange to Yellow to Green |
| InChI | 1S/C16H13NS/c1-12-17-15(13-8-4-2-5-9-13)16(18-12)14-10-6-3-7-11-14/h2-11H,1H3 |
| InChIKey | ZFYWCVZNRMSXBT-UHFFFAOYSA-N |
| SMILES | Cc1nc(-c2ccccc2)c(s1)-c3ccccc3 |
| CAS DataBase Reference | 3755-83-7(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| HS Code | 2934.10.2000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





