A5687312
Methyl 4-Bromocrotonate , >80.0%(GC) , 1117-71-1
Synonym(s):
Methyl 4-bromocrotonate
CAS NO.:1117-71-1
Empirical Formula: C5H7BrO2
Molecular Weight: 179.01
MDL number: MFCD00000246
EINECS: 214-251-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB77.60 | In Stock |
|
| 25G | RMB219.20 | In Stock |
|
| 100G | RMB768.00 | In Stock |
|
| 500g | RMB3536.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 83-85 °C13 mm Hg(lit.) |
| Density | 1.522 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 197 °F |
| storage temp. | 2-8°C |
| form | Liquid |
| color | Clear yellow |
| Specific Gravity | 1.52 |
| Water Solubility | Slightly soluble in water. |
| BRN | 1745755 |
| InChI | InChI=1S/C5H7BrO2/c1-8-5(7)3-2-4-6/h2-3H,4H2,1H3/b3-2+ |
| InChIKey | RWIKCBHOVNDESJ-NSCUHMNNSA-N |
| SMILES | C(=O)(OC)/C=C/CBr |
| CAS DataBase Reference | 1117-71-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Butenoic acid, 4-bromo-, methyl ester(1117-71-1) |
| EPA Substance Registry System | 2-Butenoic acid, 4-bromo-, methyl ester (1117-71-1) |
Description and Uses
It is a useful synthetic intermediate. It was used in the synthesis of irreversible inhibitors of EGFR and HER-2 tyrosine kinases with enhanced antitumor activities.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,C |
| Risk Statements | 37/38-41-34-20/21/22 |
| Safety Statements | 26-39-45-36/37/39 |
| RIDADR | 3265 |
| WGK Germany | 3 |
| RTECS | GQ3120000 |
| F | 8-9 |
| Hazard Note | Corrosive |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29161900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |






