A5687412
Methyl 3-Bromo-2-(bromomethyl)propionate , >97.0%(GC) , 22262-60-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB333.36 | In Stock |
|
| 25G | RMB1582.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 60-62 °C/0.4 mmHg (lit.) |
| Density | 1.82 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light red to Green |
| Specific Gravity | 1.82 |
| InChI | InChI=1S/C5H8Br2O2/c1-9-5(8)4(2-6)3-7/h4H,2-3H2,1H3 |
| InChIKey | USXVPPOARMSYGY-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C(CBr)CBr |
Description and Uses
Methyl 3-bromo-2-(bromomethyl)propionate was used in synthesis of sultams and (S)-1-benzyl-3-hydroxypyrrolidine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29159000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





