BD3120348
(S)-3-Bromo-2-methylpropan-1-ol , 95% , 98244-48-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB2240.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 177.5±0.0 °C(Predicted) |
| Density | 1.461 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 198 °F |
| storage temp. | 2-8°C |
| form | liquid |
| pka | 14+-.0.10(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| optical activity | [α]25/D +7.3°, c = 2 in chloroform |
| BRN | 4738280 |
| InChI | InChI=1S/C4H9BrO/c1-4(2-5)3-6/h4,6H,2-3H2,1H3/t4-/m1/s1 |
| InChIKey | KIBOHRIGZMLNNS-SCSAIBSYSA-N |
| SMILES | C(O)[C@H](C)CBr |
Description and Uses
(2S)-3-Bromo-2-methyl-1-propanol is used as a reagent in the preparation of of pyrazolopyrimidinamine derivatives and their tyrosine and phosphinositide kinase inhibitory activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| F | 9 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






