A5739312
Methyl 1-<WBR>cyclohexene-<WBR>1-<WBR>carboxylate , 97% , 18448-47-0
CAS NO.：18448-47-0
Empirical Formula: C8H12O2
Molecular Weight: 140.18
MDL number: MFCD00001544
EINECS: 242-331-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB55.20 | In Stock |
|
| 5G | RMB231.20 | In Stock |
|
| 10g | RMB438.40 | In Stock |
|
| 25G | RMB1024.80 | In Stock |
|
| 100g | RMB3709.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 190-192 °C |
| Density | 1.028 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point: | 165 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| color | Clear colorless |
| Water Solubility | insoluble |
| BRN | 1071971 |
| InChI | InChI=1S/C8H12O2/c1-10-8(9)7-5-3-2-4-6-7/h5H,2-4,6H2,1H3 |
| InChIKey | KXPWRCPEMHIZGU-UHFFFAOYSA-N |
| SMILES | C1(C(OC)=O)CCCCC=1 |
| CAS DataBase Reference | 18448-47-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Methyl 1-cyclohexene-1-carboxylate(18448-47-0) |
Description and Uses
Methyl 1-cyclohexene-1-carboxylate is used in the diastereoselective synthesis of cis-1,2-dialkenylcyclopropanols and methyl -7,7-dimethyl-9-oxo-1,3,4,4a,6,7,8,9,9b-decahydrodibenzo[b,d]furan-4a-carboxylate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210e-P280a-P370+P378a-P403+P235-P501a |
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| F | 10-23 |
| HS Code | 29162090 |
