A5740312
5-<WBR>Methyl-<WBR>2-<WBR>(tributylstannyl)<WBR>pyridine , 95% , 189195-41-3
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB376.00 | In Stock |
|
| 1G | RMB1166.40 | In Stock |
|
| 5g | RMB2864.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 130 °C(Press: 0.0038 Torr) |
| Density | 1.106 g/mL at 25 °C |
| refractive index | n20/D1.514 |
| Flash point: | >110℃ |
| storage temp. | 2-8°C |
| solubility | Not miscible or difficult to mix. |
| pka | 5.49±0.29(Predicted) |
| form | liquid |
| Appearance | Colorless to light yellow Liquid |
| InChI | 1S/C6H6N.3C4H9.Sn/c1-6-3-2-4-7-5-6;3*1-3-4-2;/h2-3,5H,1H3;3*1,3-4H2,2H3; |
| InChIKey | MVOHAZAWWAXIDR-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc(C)cn1 |
Description and Uses
Used in Stille cross coupling reactions.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H312-H315-H319-H360FD-H372-H410 |
| Precautionary statements | P202-P273-P280-P301+P310-P302+P352+P312-P305+P351+P338 |
| Hazard Codes | T,N |
| Risk Statements | 21-25-36/38-48/23/25-50/53 |
| Safety Statements | 36/37/39-45-60-61 |
| RIDADR | UN 2788 6.1 / PGIII |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| HS Code | 2933399990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT RE 1 |






