A5748012
6-<WBR>Methyl-<WBR>5-<WBR>nitroquinoline , 97% , 23141-61-9
CAS NO.：23141-61-9
Empirical Formula: C10H8N2O2
Molecular Weight: 188.18
MDL number: MFCD00024021
EINECS: 245-447-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB49.68 | In Stock |
|
| 1G | RMB84.96 | In Stock |
|
| 5G | RMB277.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 116-120 °C |
| Boiling point: | 330.5±27.0 °C(Predicted) |
| Density | 1.298±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | solid |
| pka | 3.04±0.15(Predicted) |
| Appearance | Light green to light brown Solid |
| BRN | 154688 |
| InChI | 1S/C10H8N2O2/c1-7-4-5-9-8(3-2-6-11-9)10(7)12(13)14/h2-6H,1H3 |
| InChIKey | CENBTULRDDPOGR-UHFFFAOYSA-N |
| SMILES | Cc1ccc2ncccc2c1[N+]([O-])=O |
Description and Uses
6-Methyl-5-nitroquinoline is a starter for fused indoles.1
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H318-H335 |
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 68-41-37/38-22 |
| Safety Statements | 26-36/37/39-39 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HS Code | 2933499090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
