A6172612
5-Nitroquinoline , 98% , 607-34-1
CAS NO.:607-34-1
Empirical Formula: C9H6N2O2
Molecular Weight: 174.16
MDL number: MFCD00006790
EINECS: 210-134-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB54.40 | In Stock |
|
| 25G | RMB167.20 | In Stock |
|
| 100G | RMB623.20 | In Stock |
|
| 250g | RMB1503.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 71-73 °C (lit.) |
| Boiling point: | 70-73°C |
| Density | 1.2190 (estimate) |
| refractive index | 1.6820 (rough estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| Water Solubility | Slightly soluble in water |
| pka | 2.80±0.12(Predicted) |
| form | powder to crystal |
| color | Plates from EtOH (aq) |
| InChI | InChI=1S/C9H6N2O2/c12-11(13)9-5-1-4-8-7(9)3-2-6-10-8/h1-6H |
| InChIKey | NDDZXHOCOKCNBM-UHFFFAOYSA-N |
| SMILES | N1C2C(=C([N+]([O-])=O)C=CC=2)C=CC=1 |
| CAS DataBase Reference | 607-34-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Quinoline, 5-nitro-(607-34-1) |
| EPA Substance Registry System | 5-Nitroquinoline (607-34-1) |
Description and Uses
5-Nitroquinoline serves as a substrate for aldehyde oxidase to study oxidative and reductive transformations, including the monitoring of product formation and relative percent activity in the presence of inhibitors such as hydralazine[6].
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H351 |
| Precautionary statements | P201-P280-P301+P312-P302+P352+P312-P304+P340+P312-P308+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-40-68-36/37/38 |
| Safety Statements | 7-22-36-45-36/37/39-26 |
| WGK Germany | 3 |
| RTECS | VC1850000 |
| Hazard Note | Irritant |
| HS Code | 29334900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 |
| Toxicity | mmo-sat 10 mg/plate MUREAV 92,29,82 |








