A5761312
4-Methylumbelliferyl α-<SC>D</SC>-galactopyranoside , 98% , 38597-12-5
Synonym(s):
4-Methylumbelliferyl-α-D-galactopyranoside - CAS 38597-12-5 - Calbiochem;4-MU-α-D-Gal;MU-alpha-GAL
CAS NO.：38597-12-5
Empirical Formula: C16H18O8
Molecular Weight: 338.31
MDL number: MFCD00063278
EINECS: 254-031-1
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB407.20 | In Stock |
|
| 100MG | RMB1040.00 | In Stock |
|
| 250MG | RMB1759.20 | In Stock |
|
| 500MG | RMB2027.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 171-173 °C |
| Boiling point: | 626.9±55.0 °C(Predicted) |
| Density | 1.522±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | H2O: 10 mg/mL hot, clear, colorless |
| pka | 12.73±0.70(Predicted) |
| form | Crystalline Powder |
| color | White to almost white |
| Water Solubility | water: 50mg/mL, clear, colorless to very faintly yellow |
| BRN | 94674 |
| Stability: | Hygroscopic |
| InChI | 1S/C16H18O8/c1-7-4-12(18)23-10-5-8(2-3-9(7)10)22-16-15(21)14(20)13(19)11(6-17)24-16/h2-5,11,13-17,19-21H,6H2,1H3/t11-,13+,14+,15-,16+/m1/s1 |
| InChIKey | YUDPTGPSBJVHCN-CHUNWDLHSA-N |
| SMILES | CC1=CC(=O)Oc2cc(O[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)ccc12 |
| CAS DataBase Reference | 38597-12-5(CAS DataBase Reference) |
Description and Uses
FFluorescent substrate for ?-galactosidase activity in cell extracts, lysosomes and human blood serum. The lower pKa of the hydrolysis product, allows its detection at phisiological pH5.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362+P364-P403+P233-P501c |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | T+ |
| Risk Statements | 26/27/28 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| F | 3-10-21 |
| HS Code | 29400090 |
| Storage Class | 11 - Combustible Solids |
