PRODUCT Properties
| Boiling point: | 129-132 °C(Press: 25 Torr) |
| Density | 1.0308 g/cm3 |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 9.29±0.10(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C9H13NO/c1-7(10)8-3-5-9(11-2)6-4-8/h3-7H,10H2,1-2H3 |
| InChIKey | JTDGKQNNPKXKII-UHFFFAOYSA-N |
| SMILES | C1(C(N)C)C=CC(OC)=CC=1 |
| CAS DataBase Reference | 6298-96-0(CAS DataBase Reference) |
Description and Uses
1-(4-methoxy-phenyl)-ethylamine is useful as chiral resolving agent, chiral auxiliary, chiral base and catalyst for asymmetric synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xi,C |
| Risk Statements | 22-34 |
| Safety Statements | 26-36/37/39-45 |
| HazardClass | IRRITANT |
| REACH Registrations | Inactive |





