PRODUCT Properties
| Melting point: | 158 °C |
| Boiling point: | 285.1±9.0 °C(Predicted) |
| Density | 1.186±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder |
| pka | 14.39±0.40(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C8H8N2/c1-6-3-2-4-7-5-9-10-8(6)7/h2-5H,1H3,(H,9,10) |
| InChIKey | RLAZPAQEVQDPHR-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2C)C=N1 |
Description and Uses
7-Methyl-1H-indazole, can be used for the synthesis of 2-[(Heteroaryl)methyl]imidazolines, having activities at α1- and α2-adrenoceptors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |
