A6108812
Mesityl(phenyl)methanone , 98% , 954-16-5
CAS NO.:954-16-5
Empirical Formula: C16H16O
Molecular Weight: 224.3
MDL number: MFCD02685558
EINECS: 403-150-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5g | RMB30.40 | In Stock |
|
| 25g | RMB110.40 | In Stock |
|
| 100g | RMB343.20 | In Stock |
|
| 500g | RMB1119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 35 °C |
| Boiling point: | 326.5-327 °C(Press: 777 Torr) |
| Density | 1.036±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly) |
| form | Low-Melting Solid |
| color | White to Off-White |
| Cosmetics Ingredients Functions | LIGHT STABILIZER |
| InChI | InChI=1S/C16H16O/c1-11-9-12(2)15(13(3)10-11)16(17)14-7-5-4-6-8-14/h4-10H,1-3H3 |
| InChIKey | HPAFOABSQZMTHE-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC=C1)(C1=C(C)C=C(C)C=C1C)=O |
| LogP | 4.560 (est) |
| CAS DataBase Reference | 954-16-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzophenone, 2,4,6-trimethyl-(954-16-5) |
| EPA Substance Registry System | Methanone, phenyl(2,4,6-trimethylphenyl)- (954-16-5) |
Description and Uses
2,4,6-Trimethylbenzophenone can be used for a consensus modeling for prediction of estrogenic activity of ingredients commonly used in sunscreen products.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xn,N |
| Risk Statements | 22-36-50/53 |
| Safety Statements | 26-60-61 |
| TSCA | TSCA listed |







