PRODUCT Properties
| Melting point: | 207 °C |
| Boiling point: | 383.3±15.0 °C(Predicted) |
| Density | 1.525±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 11.71±0.40(Predicted) |
| color | White to Light red to Green |
| BRN | 7936 |
| InChI | InChI=1S/C7H5N3O2/c11-10(12)6-1-2-7-5(3-6)4-8-9-7/h1-4H,(H,8,9) |
| InChIKey | WSGURAYTCUVDQL-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C([N+]([O-])=O)C=C2)C=N1 |
| CAS DataBase Reference | 5401-94-5(CAS DataBase Reference) |
| EPA Substance Registry System | 5-Nitroindazole (5401-94-5) |
Description and Uses
5-Nitroindazole inhibits citrulline formation by Ca2+-calmodulin (CaM)-dependent nitric oxide synthase from bovine brain. Nitration of 5-nitroindazole with nitric acid and acetic anhydride yields 3,5-dintroindazole and 2,5-dinitroindazole.
Safety
| Symbol(GHS) |   GHS08,GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335-H341 |
| Precautionary statements | P261-P305+P351+P338-P201-P280-P405-P501a |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38-68-36-20/21/22 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 2 |
| RTECS | NK7962000 |
| Hazard Note | Irritant |
| TSCA | Yes |
| HS Code | 29339990 |
