A6165812
2-Nitrophenyl β-D-glucopyranoside , 99% , 2816-24-2
Synonym(s):
2-Nitrophenyl-beta-D-glucopyranoside;o-NPG
CAS NO.:2816-24-2
Empirical Formula: C12H15NO8
Molecular Weight: 301.25
MDL number: MFCD00065048
EINECS: 220-568-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB45.60 | In Stock |
|
| 1G | RMB106.40 | In Stock |
|
| 5G | RMB286.40 | In Stock |
|
| 25g | RMB495.20 | In Stock |
|
| 100g | RMB1759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 141-142℃ |
| Boiling point: | 572.4±50.0 °C(Predicted) |
| Density | 1.599±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | Methanol (Slightly), Water (Slightly) |
| form | powder |
| pka | 12.69±0.70(Predicted) |
| color | light yellow |
| Water Solubility | Soluble in water |
| BRN | 92206 |
| InChI | InChI=1/C12H15NO8/c14-5-8-9(15)10(16)11(17)12(21-8)20-7-4-2-1-3-6(7)13(18)19/h1-4,8-12,14-17H,5H2/t8-,9+,10+,11-,12-/s3 |
| InChIKey | KUWPCJHYPSUOFW-IDEGKBHYNA-N |
| SMILES | [C@@H]1([C@H](O)[C@H]([C@@H](O)[C@@H](CO)O1)O)OC1C=CC=CC=1[N+]([O-])=O |&1:0,1,3,4,6,r| |
| CAS DataBase Reference | 2816-24-2(CAS DataBase Reference) |
Description and Uses
2-Nitrophenyl b-D-Glucopyranoside is used in preparation of phenol glycosides and their use in treatment of urolithiasis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| F | 3-10-21 |
| HS Code | 29400090 |
| Storage Class | 11 - Combustible Solids |






