2-Nitrophenyl β-D-galactopyranoside , 99%, non -animal source , 369-07-3
Synonym(s):
o-Nitrophenyl β-D -galactopyranoside;o-Nitrophenyl-β-D-galactopyranoside - CAS 369-07-3 - Calbiochem;o-NPG;ONPG;ONPG 
CAS NO.:369-07-3
Empirical Formula: C12H15NO8
Molecular Weight: 301.25
MDL number: MFCD00063255
EINECS: 206-716-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB73.60 | In Stock |
|
| 5G | RMB228.80 | In Stock |
|
| 25G | RMB696.80 | In Stock |
|
| 100g | RMB2497.60 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 186-193 °C (dec.) |
| alpha | -70 º (c=1, H2O) |
| Boiling point: | 442.39°C (rough estimate) |
| Density | 1.3709 (rough estimate) |
| refractive index | -68.8 ° (C=1, H2O) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Water (Slightly, Heated, Sonicated) |
| pka | 12.69±0.70(Predicted) |
| form | Powder |
| color | White to very slightly yellow |
| optical activity | [α]20/D 70±1°, c = 1% in H2O |
| Water Solubility | Soluble in water. |
| BRN | 92207 |
| InChI | 1S/C12H15NO8/c14-5-8-9(15)10(16)11(17)12(21-8)20-7-4-2-1-3-6(7)13(18)19/h1-4,8-12,14-17H,5H2/t8-,9+,10+,11-,12-/m1/s1 |
| InChIKey | KUWPCJHYPSUOFW-RMPHRYRLSA-N |
| SMILES | OC[C@H]1O[C@@H](Oc2ccccc2[N+]([O-])=O)[C@H](O)[C@@H](O)[C@H]1O |
| CAS DataBase Reference | 369-07-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Galactopyranoside, o-nitrophenyl, beta-d-(369-07-3) |
Description and Uses
2-Nitrophenyl-β-D-galactopyranoside (ONPG) is a colorimetric and spectrophotometric substrate for detecting β-galactosidase activity. This compound is usually colorless. However, if β-galactosidase is present, it hydrolyzes the ONPG molecule into galactose and ortho-nitrophenol. The latter compound has a yellow color that can be used to check for enzyme activity utilizing a colorimetric assay (at 420 nm wavelength). β-Galactosidase is required for lactose utilization, so the intensity of the color produced can be used to measure the enzymatic rate. Though ONPG mimics lactose and is hydrolyzed by β-galactosidase, it cannot act as an inducer for the lac operon. Without another lactose analog that can act as an inducer, such as isopropyl β-D-1-thiogalactopyranoside (IPTG), β-galactosidase will not be transcribed and ONPG will not be hydrolyzed.
2-Nitrophenyl-beta-D-galactopyranoside is a β-Galactosidase substrate for colorimetric and EIA applications; counterpart of widely employed pNPP/alkaline phosphatase substrate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362+P364-P403+P233-P501c |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| F | 3-10-21 |
| HS Code | 29400090 |
| Storage Class | 11 - Combustible Solids |






