A6195812
Nonafluorobutane-1-sulfonic acid , 98% , 375-73-5
CAS NO.:375-73-5
Empirical Formula: C4HF9O3S
Molecular Weight: 300.1
MDL number: MFCD01320794
EINECS: 206-793-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB47.20 | In Stock |
|
| 25G | RMB159.20 | In Stock |
|
| 100g | RMB511.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 112-114 °C/14 mmHg (lit.) |
| Density | 1.811 g/mL at 25 °C (lit.) |
| vapor pressure | 7Pa at 20℃ |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Soluble in water |
| pka | -3.57±0.50(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Water Solubility | 1000g/L at 20℃ |
| InChI | InChI=1S/C4HF9O3S/c5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h(H,14,15,16) |
| InChIKey | JGTNAGYHADQMCM-UHFFFAOYSA-N |
| SMILES | C(F)(F)(S(O)(=O)=O)C(F)(F)C(F)(F)C(F)(F)F |
| LogP | -0.34 at 23℃ |
| CAS DataBase Reference | 375-73-5(CAS DataBase Reference) |
| EPA Substance Registry System | Perfluorobutanesulfonic acid (375-73-5) |
Description and Uses
Nonafluorobutane-1-sulfonic acid may be used as catalyst in the synthesis of 6-chloro-6H-dibenz[c,e][1,2]oxaphosphorin and N-benzylpyridin-2-amine.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314 |
| Precautionary statements | P270-P280-P301+P312-P301+P330+P331-P303+P361+P353-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 14-22-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| RTECS | EK5930000 |
| TSCA | TSCA listed |
| HazardClass | CORROSIVE |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B |
| Hazardous Substances Data | 375-73-5(Hazardous Substances Data) |
| Toxicity | LD50 orl-rat: 430 mg/kg ATDAEI 15(Suppl 1),S105,1996 |







