A6195912
Nonafluorobutanesulfonic anhydride , 97% , 36913-91-4
CAS NO.:36913-91-4
Empirical Formula: C8F18O5S2
Molecular Weight: 582.17
MDL number: MFCD03427256
EINECS: 253-270-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB219.20 | In Stock |
|
| 5G | RMB768.00 | In Stock |
|
| 25g | RMB2568.80 | In Stock |
|
| 100g | RMB7591.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 84 °C (lit.) |
| Density | 1.898 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| form | liquid |
| color | Colourless |
| InChI | 1S/C8F18O5S2/c9-1(10,5(17,18)19)3(13,14)7(23,24)32(27,28)31-33(29,30)8(25,26)4(15,16)2(11,12)6(20,21)22 |
| InChIKey | QKIHLPFZYGFMDK-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| EPA Substance Registry System | Perfluorobutanesulfonic anhydride (36913-91-4) |
Description and Uses
Nonafluorobutanesulfonic anhydride can play the role of an activating agent in the synthesis of 4-bromothieno[2,3-b]pyridine via reaction with tetra-n-butylammonium bromide in dichloromethane.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| Hazard Codes | C |
| Risk Statements | 14-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3264 8/PG 2 |
| WGK Germany | 3 |
| HS Code | 2904990090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |




