PRODUCT Properties
| Melting point: | 81-83 °C (lit.) |
| Boiling point: | 234 °C |
| Density | 1.5553 (rough estimate) |
| refractive index | 1.5423 (estimate) |
| storage temp. | RT, stored under nitrogen |
| form | Crystalline Powder |
| pka | 4.88±0.10(Predicted) |
| color | Orange |
| Water Solubility | Slightly soluble in water. Solubility in methanol is almost transparent. |
| BRN | 2048819 |
| InChI | InChI=1S/C6H5NO4/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3,8-9H |
| InChIKey | ZLCPKMIJYMHZMJ-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=CC(O)=C1[N+]([O-])=O |
| CAS DataBase Reference | 601-89-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Nitro-1,3-dihydroxybenzene(601-89-8) |
| EPA Substance Registry System | 1,3-Benzenediol, 2-nitro- (601-89-8) |
Description and Uses
2-Nitroresorcinol is a good subject for detecting intramolecular hydrogen bonding. 2-Nitroresorcinol can be used as a starting material to prepare 4-Hydroxy-2-benzoxazolone, HBOA.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-24/25 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Autoignition Temperature | 800 °F |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29089990 |
