A6240912
N6-Benzoyladenine , ≥98.0%(HPLC) , 4005-49-6
Synonym(s):
n6-benzoyl adenosine
CAS NO.:4005-49-6
Empirical Formula: C12H9N5O
Molecular Weight: 239.23
MDL number: MFCD00037927
EINECS: 629-048-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB51.20 | In Stock |
|
| 25G | RMB140.80 | In Stock |
|
| 100g | RMB479.20 | In Stock |
|
| 500g | RMB2303.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 242-244°C |
| Density | 1.494 g/cm3 |
| storage temp. | 2-8°C |
| Water Solubility | Insoluble in water |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | powder to crystal |
| pka | 11.98±0.20(Predicted) |
| color | White to Almost white |
| BRN | 20585 |
| InChI | InChI=1S/C12H9N5O/c18-12(8-4-2-1-3-5-8)17-11-9-10(14-6-13-9)15-7-16-11/h1-7H,(H2,13,14,15,16,17,18) |
| InChIKey | QQJXZVKXNSFHRI-UHFFFAOYSA-N |
| SMILES | C(NC1=C2C(=NC=N1)NC=N2)(=O)C1=CC=CC=C1 |
| CAS DataBase Reference | 4005-49-6(CAS DataBase Reference) |
Description and Uses
N6-Benzoyladenine is used in the organic synthesis of adenine derivative molecules such as bicyclic adenine nucleoside via a condensation reaction between L-threo-pentofuranose derivative 1 and 6-N-benzoyladenine and to produce oxy-peptide nucleic acids.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H317-H361d |
| Precautionary statements | P202-P261-P280-P301+P312-P302+P352-P308+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-43 |
| Safety Statements | 36/37 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Repr. 2 Skin Sens. 1 |







