A6256812
Neosolaniol , ≥98% , 36519-25-2
Synonym(s):
4β,15-Diacetoxy-3α,8α-dihydroxy-12,13-epoxytrichothec-9-ene;8-Hydroxydiacetoxyscirpenol;8-Hydroxydiacetoxyscirpenol solution;NEO;Neosolaniol from Fusarium sp.
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB903.20 | In Stock |
|
| 5MG | RMB3343.20 | In Stock |
|
| 25MG | RMB14399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 171.5°C |
| Boiling point: | 420.3°C (rough estimate) |
| Density | 1.2248 (rough estimate) |
| refractive index | 1.4430 (estimate) |
| Flash point: | 2 °C |
| storage temp. | 2-8°C |
| solubility | DMF: 30 mg/ml; DMF:PBS (pH 7.2) (1:4): 0.2 mg/ml; DMSO: 30 mg/ml; Ethanol: 20 mg/ml |
| form | Solid |
| pka | 13.32±0.70(Predicted) |
| color | White to off-white |
| Major Application | agriculture cleaning products cosmetics food and beverages personal care |
| InChIKey | TVZHDVCTOCZDNE-WVJYZQHISA-N |
| SMILES | CC(=O)OC[C@]12C[C@H](O)C(C)=C[C@H]1O[C@@H]3[C@H](O)[C@@H](OC(C)=O)[C@@]2(C)[C@]34CO4 |
Description and Uses
Neosolaniol is a mycotoxin produced by Fusarium species commonly found in wheat and maize.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330 |
| Precautionary statements | P260-P262-P264-P280-P302+P352+P310-P304+P340+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T+,Xn,F |
| Risk Statements | 26/27/28-36-20/21/22-11 |
| Safety Statements | 22-36/37/39-45-36/37-16-26 |
| RIDADR | UN 2811 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | YD0080000 |
| HazardClass | 6.1(a) |
| PackingGroup | I |
| HS Code | 29329990 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Inhalation Acute Tox. 2 Dermal Acute Tox. 2 Oral |
